C15H25ClO — CID 143502793
(2E,4E,6Z)-3-chloro-5-heptan-4-yloxyocta-2,4,6-triene (PubChem CID 143502793) has the molecular formula C15H25ClO and a molecular weight of 256.82 g/mol. Its IUPAC name is (2E,4E,6Z)-3-chloro-5-heptan-4-yloxyocta-2,4,6-triene.
| Compound Name | (2E,4E,6Z)-3-chloro-5-heptan-4-yloxyocta-2,4,6-triene |
|---|---|
| PubChem CID | 143502793 |
| Molecular Formula | C15H25ClO |
| Molecular Weight | 256.82 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | (2E,4E,6Z)-3-chloro-5-heptan-4-yloxyocta-2,4,6-triene |
| SMILES | C/C=C\C(=C/C(Cl)=C\C)OC(CCC)CCC |
| InChI | InChI=1S/C15H25ClO/c1-5-9-14(10-6-2)17-15(11-7-3)12-13(16)8-4/h7-8,11-12,14H,5-6,9-10H2,1-4H3/b11-7-,13-8+,15-12+ |
| InChIKey | OOUBQCJQCQQARZ-AEYFRVGWSA-N |
| XLogP | 5.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.82 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|