C7H10Cl3F3 — CID 14350311
2,2,4-trichloro-1,1,1-trifluoro-5-methylhexane (PubChem CID 14350311) has the molecular formula C7H10Cl3F3 and a molecular weight of 257.51 g/mol. Its IUPAC name is 2,2,4-trichloro-1,1,1-trifluoro-5-methylhexane.
| Compound Name | 2,2,4-trichloro-1,1,1-trifluoro-5-methylhexane |
|---|---|
| PubChem CID | 14350311 |
| Molecular Formula | C7H10Cl3F3 |
| Molecular Weight | 257.51 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | 2,2,4-trichloro-1,1,1-trifluoro-5-methylhexane |
| SMILES | CC(C)C(Cl)CC(Cl)(Cl)C(F)(F)F |
| InChI | InChI=1S/C7H10Cl3F3/c1-4(2)5(8)3-6(9,10)7(11,12)13/h4-5H,3H2,1-2H3 |
| InChIKey | JXOGUSUARSCHAD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|