C26H28N6O2 — CID 143503144
7-methoxy-1-[4-[4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]butyl]indole-3-carbonitrile (PubChem CID 143503144) has the molecular formula C26H28N6O2 and a molecular weight of 456.55 g/mol. Its IUPAC name is 7-methoxy-1-[4-[4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]butyl]indole-3-carbonitrile.
| Compound Name | 7-methoxy-1-[4-[4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]butyl]indole-3-carbonitrile |
|---|---|
| PubChem CID | 143503144 |
| Molecular Formula | C26H28N6O2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 7-methoxy-1-[4-[4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]butyl]indole-3-carbonitrile |
| SMILES | COc1cccc2c(C#N)cn(CCCCN3CCC(c4nc(-c5ccncc5)no4)CC3)c12 |
| InChI | InChI=1S/C26H28N6O2/c1-33-23-6-4-5-22-21(17-27)18-32(24(22)23)14-3-2-13-31-15-9-20(10-16-31)26-29-25(30-34-26)19-7-11-28-12-8-19/h4-8,11-12,18,20H,2-3,9-10,13-16H2,1H3 |
| InChIKey | KNQCNEXPMRLZSK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 93.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|