C38H46ClN3O7 — CID 143503241
N-[(3E)-4-chloro-2-methylidenehexa-3,5-dienyl]-7-methoxy-1-[3-(3-phenacyl-8-azabicyclo[3.2.1]octan-8-yl)propyl]indole-3-carboxamide;methanol;oxaldehydic acid (PubChem CID 143503241) has the molecular formula C38H46ClN3O7 and a molecular weight of 692.25 g/mol. Its IUPAC name is N-[(3E)-4-chloro-2-methylidenehexa-3,5-dienyl]-7-methoxy-1-[3-(3-phenacyl-8-azabicyclo[3.2.1]octan-8-yl)propyl]indole-3-carboxamide;methanol;oxaldehydic acid.
| Compound Name | N-[(3E)-4-chloro-2-methylidenehexa-3,5-dienyl]-7-methoxy-1-[3-(3-phenacyl-8-azabicyclo[3.2.1]octan-8-yl)propyl]indole-3-carboxamide;methanol;oxaldehydic acid |
|---|---|
| PubChem CID | 143503241 |
| Molecular Formula | C38H46ClN3O7 |
| Molecular Weight | 692.25 g/mol |
| Exact Mass | 691.30 |
| IUPAC Name | N-[(3E)-4-chloro-2-methylidenehexa-3,5-dienyl]-7-methoxy-1-[3-(3-phenacyl-8-azabicyclo[3.2.1]octan-8-yl)propyl]indole-3-carboxamide;methanol;oxaldehydic acid |
| SMILES | C=C/C(Cl)=C\C(=C)CNC(=O)c1cn(CCCN2C3CCC2CC(CC(=O)c2ccccc2)C3)c2c(OC)cccc12.CO.O=CC(=O)O |
| InChI | InChI=1S/C35H40ClN3O3.C2H2O3.CH4O/c1-4-27(36)18-24(2)22-37-35(41)31-23-38(34-30(31)12-8-13-33(34)42-3)16-9-17-39-28-14-15-29(39)20-25(19-28)21-32(40)26-10-6-5-7-11-26;3-1-2(4)5;1-2/h4-8,10-13,18,23,25,28-29H,1-2,9,14-17,19-22H2,3H3,(H,37,41);1H,(H,4,5);2H,1H3/b27-18+;; |
| InChIKey | ACSLEFKQVUQUGT-FDTNUAQMSA-N |
| XLogP | 6.03 |
| TPSA | 138.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.25 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|