C14H22O2 — CID 143503821
ethane;2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,3-dioxane (PubChem CID 143503821) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is ethane;2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,3-dioxane.
| Compound Name | ethane;2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 143503821 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | ethane;2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,3-dioxane |
| SMILES | C=C/C=C\C(=C/C=C)C1OCCCO1.CC |
| InChI | InChI=1S/C12H16O2.C2H6/c1-3-5-8-11(7-4-2)12-13-9-6-10-14-12;1-2/h3-5,7-8,12H,1-2,6,9-10H2;1-2H3/b8-5-,11-7+; |
| InChIKey | RQTAMBYVXCODFQ-UJCNWHNNSA-N |
| XLogP | 3.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|