C18H18N6O — CID 143504000
1-[3-(2,3-dihydro-1H-indol-5-yl)pyrido[2,3-b]pyrazin-6-yl]-3-ethylurea (PubChem CID 143504000) has the molecular formula C18H18N6O and a molecular weight of 334.38 g/mol. Its IUPAC name is 1-[3-(2,3-dihydro-1H-indol-5-yl)pyrido[2,3-b]pyrazin-6-yl]-3-ethylurea.
| Compound Name | 1-[3-(2,3-dihydro-1H-indol-5-yl)pyrido[2,3-b]pyrazin-6-yl]-3-ethylurea |
|---|---|
| PubChem CID | 143504000 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-[3-(2,3-dihydro-1H-indol-5-yl)pyrido[2,3-b]pyrazin-6-yl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1ccc2ncc(-c3ccc4c(c3)CCN4)nc2n1 |
| InChI | InChI=1S/C18H18N6O/c1-2-19-18(25)24-16-6-5-14-17(23-16)22-15(10-21-14)11-3-4-13-12(9-11)7-8-20-13/h3-6,9-10,20H,2,7-8H2,1H3,(H2,19,22,23,24,25) |
| InChIKey | ARLZIWLTKKGQMU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |