About 4-[[3,5-di(propan-2-yl)phenyl]methyl]-2-(2-methylpropyl)-6-propan-2-ylphenol;ethane
4-[[3,5-di(propan-2-yl)phenyl]methyl]-2-(2-methylpropyl)-6-propan-2-ylphenol;ethane (PubChem CID 143504508) has the molecular formula C28H44O
and a molecular weight of 396.66 g/mol. Its IUPAC name is 4-[[3,5-di(propan-2-yl)phenyl]methyl]-2-(2-methylpropyl)-6-propan-2-ylphenol;ethane.
Molecular Properties
| Compound Name | 4-[[3,5-di(propan-2-yl)phenyl]methyl]-2-(2-methylpropyl)-6-propan-2-ylphenol;ethane |
| PubChem CID | 143504508 |
| Molecular Formula | C28H44O |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 396.34 |
| IUPAC Name | 4-[[3,5-di(propan-2-yl)phenyl]methyl]-2-(2-methylpropyl)-6-propan-2-ylphenol;ethane |
| SMILES | CC.CC(C)Cc1cc(Cc2cc(C(C)C)cc(C(C)C)c2)cc(C(C)C)c1O |
| InChI | InChI=1S/C26H38O.C2H6/c1-16(2)9-24-13-21(14-25(19(7)8)26(24)27)10-20-11-22(17(3)4)15-23(12-20)18(5)6;1-2/h11-19,27H,9-10H2,1-8H3;1-2H3 |
| InChIKey | QYLSATCEFBLYNS-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[[3,5-di(propan-2-yl)phenyl]methyl]-2-(2-methylpropyl)-6-propan-2-ylphenol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3,5-di(propan-2-yl)phenyl]methyl]-2-(2-methylpropyl)-6-propan-2-ylphenol;ethane?
The IUPAC name of 4-[[3,5-di(propan-2-yl)phenyl]methyl]-2-(2-methylpropyl)-6-propan-2-ylphenol;ethane (CID 143504508) is 4-[[3,5-di(propan-2-yl)phenyl]methyl]-2-(2-methylpropyl)-6-propan-2-ylphenol;ethane.
What is the SMILES notation for 4-[[3,5-di(propan-2-yl)phenyl]methyl]-2-(2-methylpropyl)-6-propan-2-ylphenol;ethane?
The canonical SMILES for 4-[[3,5-di(propan-2-yl)phenyl]methyl]-2-(2-methylpropyl)-6-propan-2-ylphenol;ethane is CC.CC(C)Cc1cc(Cc2cc(C(C)C)cc(C(C)C)c2)cc(C(C)C)c1O.
What is the InChIKey of 4-[[3,5-di(propan-2-yl)phenyl]methyl]-2-(2-methylpropyl)-6-propan-2-ylphenol;ethane?
The InChIKey is QYLSATCEFBLYNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H38O.C2H6/c1-16(2)9-24-13-21(14-25(19(7)8)26(24)27)10-20-11-22(17(3)4)15-23(12-20)18(5)6;1-2/h11-19,27H,9-10H2,1-8H3;1-2H3.
What are the key properties of 4-[[3,5-di(propan-2-yl)phenyl]methyl]-2-(2-methylpropyl)-6-propan-2-ylphenol;ethane?
4-[[3,5-di(propan-2-yl)phenyl]methyl]-2-(2-methylpropyl)-6-propan-2-ylphenol;ethane has a molecular weight of 396.66 g/mol, XLogP of 8.58, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3,5-di(propan-2-yl)phenyl]methyl]-2-(2-methylpropyl)-6-propan-2-ylphenol;ethane is sourced from PubChem (CID 143504508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).