C16H23NO — CID 143504528
2,4-diethyl-4-methyl-5-methylidene-1,3-oxazole;toluene (PubChem CID 143504528) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 2,4-diethyl-4-methyl-5-methylidene-1,3-oxazole;toluene.
| Compound Name | 2,4-diethyl-4-methyl-5-methylidene-1,3-oxazole;toluene |
|---|---|
| PubChem CID | 143504528 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 2,4-diethyl-4-methyl-5-methylidene-1,3-oxazole;toluene |
| SMILES | C=C1OC(CC)=NC1(C)CC.Cc1ccccc1 |
| InChI | InChI=1S/C9H15NO.C7H8/c1-5-8-10-9(4,6-2)7(3)11-8;1-7-5-3-2-4-6-7/h3,5-6H2,1-2,4H3;2-6H,1H3 |
| InChIKey | XAUMRVYOROOPGH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |