About ethane;methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate
ethane;methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate (PubChem CID 143504543) has the molecular formula C16H27NO3
and a molecular weight of 281.40 g/mol. Its IUPAC name is ethane;methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | ethane;methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate |
| PubChem CID | 143504543 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | ethane;methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate |
| SMILES | C=C/C=C(\C)C(=O)NC1(C(=O)OC)CCCCC1.CC |
| InChI | InChI=1S/C14H21NO3.C2H6/c1-4-8-11(2)12(16)15-14(13(17)18-3)9-6-5-7-10-14;1-2/h4,8H,1,5-7,9-10H2,2-3H3,(H,15,16);1-2H3/b11-8+; |
| InChIKey | FCQRGTJWKHCGNU-YGCVIUNWSA-N |
| XLogP | 3.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate?
The IUPAC name of ethane;methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate (CID 143504543) is ethane;methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate.
What is the SMILES notation for ethane;methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate?
The canonical SMILES for ethane;methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate is C=C/C=C(\C)C(=O)NC1(C(=O)OC)CCCCC1.CC.
What is the InChIKey of ethane;methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate?
The InChIKey is FCQRGTJWKHCGNU-YGCVIUNWSA-N. The full InChI is InChI=1S/C14H21NO3.C2H6/c1-4-8-11(2)12(16)15-14(13(17)18-3)9-6-5-7-10-14;1-2/h4,8H,1,5-7,9-10H2,2-3H3,(H,15,16);1-2H3/b11-8+;.
What are the key properties of ethane;methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate?
ethane;methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate has a molecular weight of 281.40 g/mol, XLogP of 3.14, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate is sourced from PubChem (CID 143504543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).