About methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate
methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate (PubChem CID 143504544) has the molecular formula C14H21NO3
and a molecular weight of 251.33 g/mol. Its IUPAC name is methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate |
| PubChem CID | 143504544 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate |
| SMILES | C=C/C=C(\C)C(=O)NC1(C(=O)OC)CCCCC1 |
| InChI | InChI=1S/C14H21NO3/c1-4-8-11(2)12(16)15-14(13(17)18-3)9-6-5-7-10-14/h4,8H,1,5-7,9-10H2,2-3H3,(H,15,16)/b11-8+ |
| InChIKey | KSTLTULHWWQPSS-DHZHZOJOSA-N |
| XLogP | 2.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate?
The IUPAC name of methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate (CID 143504544) is methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate.
What is the SMILES notation for methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate?
The canonical SMILES for methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate is C=C/C=C(\C)C(=O)NC1(C(=O)OC)CCCCC1.
What is the InChIKey of methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate?
The InChIKey is KSTLTULHWWQPSS-DHZHZOJOSA-N. The full InChI is InChI=1S/C14H21NO3/c1-4-8-11(2)12(16)15-14(13(17)18-3)9-6-5-7-10-14/h4,8H,1,5-7,9-10H2,2-3H3,(H,15,16)/b11-8+.
What are the key properties of methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate?
methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate has a molecular weight of 251.33 g/mol, XLogP of 2.11, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[[(2E)-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylate is sourced from PubChem (CID 143504544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).