C18H29NO — CID 143504633
1-(1-phenylmethoxyethenyl)cyclohexan-1-amine;propane (PubChem CID 143504633) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is 1-(1-phenylmethoxyethenyl)cyclohexan-1-amine;propane.
| Compound Name | 1-(1-phenylmethoxyethenyl)cyclohexan-1-amine;propane |
|---|---|
| PubChem CID | 143504633 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 1-(1-phenylmethoxyethenyl)cyclohexan-1-amine;propane |
| SMILES | C=C(OCc1ccccc1)C1(N)CCCCC1.CCC |
| InChI | InChI=1S/C15H21NO.C3H8/c1-13(15(16)10-6-3-7-11-15)17-12-14-8-4-2-5-9-14;1-3-2/h2,4-5,8-9H,1,3,6-7,10-12,16H2;3H2,1-2H3 |
| InChIKey | ZBHZBDKONNQFDV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|