About 1-octyl-4-phenylsulfanylbenzene;phenylmethanol
1-octyl-4-phenylsulfanylbenzene;phenylmethanol (PubChem CID 143504950) has the molecular formula C27H34OS
and a molecular weight of 406.64 g/mol. Its IUPAC name is 1-octyl-4-phenylsulfanylbenzene;phenylmethanol.
Molecular Properties
| Compound Name | 1-octyl-4-phenylsulfanylbenzene;phenylmethanol |
| PubChem CID | 143504950 |
| Molecular Formula | C27H34OS |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 1-octyl-4-phenylsulfanylbenzene;phenylmethanol |
| SMILES | CCCCCCCCc1ccc(Sc2ccccc2)cc1.OCc1ccccc1 |
| InChI | InChI=1S/C20H26S.C7H8O/c1-2-3-4-5-6-8-11-18-14-16-20(17-15-18)21-19-12-9-7-10-13-19;8-6-7-4-2-1-3-5-7/h7,9-10,12-17H,2-6,8,11H2,1H3;1-5,8H,6H2 |
| InChIKey | QPQUHNCOLDIZSG-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-octyl-4-phenylsulfanylbenzene;phenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-octyl-4-phenylsulfanylbenzene;phenylmethanol?
The IUPAC name of 1-octyl-4-phenylsulfanylbenzene;phenylmethanol (CID 143504950) is 1-octyl-4-phenylsulfanylbenzene;phenylmethanol.
What is the SMILES notation for 1-octyl-4-phenylsulfanylbenzene;phenylmethanol?
The canonical SMILES for 1-octyl-4-phenylsulfanylbenzene;phenylmethanol is CCCCCCCCc1ccc(Sc2ccccc2)cc1.OCc1ccccc1.
What is the InChIKey of 1-octyl-4-phenylsulfanylbenzene;phenylmethanol?
The InChIKey is QPQUHNCOLDIZSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26S.C7H8O/c1-2-3-4-5-6-8-11-18-14-16-20(17-15-18)21-19-12-9-7-10-13-19;8-6-7-4-2-1-3-5-7/h7,9-10,12-17H,2-6,8,11H2,1H3;1-5,8H,6H2.
What are the key properties of 1-octyl-4-phenylsulfanylbenzene;phenylmethanol?
1-octyl-4-phenylsulfanylbenzene;phenylmethanol has a molecular weight of 406.64 g/mol, XLogP of 7.92, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-octyl-4-phenylsulfanylbenzene;phenylmethanol is sourced from PubChem (CID 143504950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).