About 4-[3-(1-benzothiophen-2-yl)propyl]-2,3-bis(ethenyl)pyridine
4-[3-(1-benzothiophen-2-yl)propyl]-2,3-bis(ethenyl)pyridine (PubChem CID 143504980) has the molecular formula C20H19NS
and a molecular weight of 305.45 g/mol. Its IUPAC name is 4-[3-(1-benzothiophen-2-yl)propyl]-2,3-bis(ethenyl)pyridine.
Molecular Properties
| Compound Name | 4-[3-(1-benzothiophen-2-yl)propyl]-2,3-bis(ethenyl)pyridine |
| PubChem CID | 143504980 |
| Molecular Formula | C20H19NS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 4-[3-(1-benzothiophen-2-yl)propyl]-2,3-bis(ethenyl)pyridine |
| SMILES | C=Cc1nccc(CCCc2cc3ccccc3s2)c1C=C |
| InChI | InChI=1S/C20H19NS/c1-3-18-15(12-13-21-19(18)4-2)9-7-10-17-14-16-8-5-6-11-20(16)22-17/h3-6,8,11-14H,1-2,7,9-10H2 |
| InChIKey | PIWRBWWZEVZJNQ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[3-(1-benzothiophen-2-yl)propyl]-2,3-bis(ethenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(1-benzothiophen-2-yl)propyl]-2,3-bis(ethenyl)pyridine?
The IUPAC name of 4-[3-(1-benzothiophen-2-yl)propyl]-2,3-bis(ethenyl)pyridine (CID 143504980) is 4-[3-(1-benzothiophen-2-yl)propyl]-2,3-bis(ethenyl)pyridine.
What is the SMILES notation for 4-[3-(1-benzothiophen-2-yl)propyl]-2,3-bis(ethenyl)pyridine?
The canonical SMILES for 4-[3-(1-benzothiophen-2-yl)propyl]-2,3-bis(ethenyl)pyridine is C=Cc1nccc(CCCc2cc3ccccc3s2)c1C=C.
What is the InChIKey of 4-[3-(1-benzothiophen-2-yl)propyl]-2,3-bis(ethenyl)pyridine?
The InChIKey is PIWRBWWZEVZJNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NS/c1-3-18-15(12-13-21-19(18)4-2)9-7-10-17-14-16-8-5-6-11-20(16)22-17/h3-6,8,11-14H,1-2,7,9-10H2.
What are the key properties of 4-[3-(1-benzothiophen-2-yl)propyl]-2,3-bis(ethenyl)pyridine?
4-[3-(1-benzothiophen-2-yl)propyl]-2,3-bis(ethenyl)pyridine has a molecular weight of 305.45 g/mol, XLogP of 5.76, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(1-benzothiophen-2-yl)propyl]-2,3-bis(ethenyl)pyridine is sourced from PubChem (CID 143504980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).