C12H22N2O — CID 143505469
(3E,5E)-6-[2-[ethyl(methyl)amino]ethylamino]hepta-1,3,5-trien-3-ol (PubChem CID 143505469) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is (3E,5E)-6-[2-[ethyl(methyl)amino]ethylamino]hepta-1,3,5-trien-3-ol.
| Compound Name | (3E,5E)-6-[2-[ethyl(methyl)amino]ethylamino]hepta-1,3,5-trien-3-ol |
|---|---|
| PubChem CID | 143505469 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | (3E,5E)-6-[2-[ethyl(methyl)amino]ethylamino]hepta-1,3,5-trien-3-ol |
| SMILES | C=C/C(O)=C\C=C(/C)NCCN(C)CC |
| InChI | InChI=1S/C12H22N2O/c1-5-12(15)8-7-11(3)13-9-10-14(4)6-2/h5,7-8,13,15H,1,6,9-10H2,2-4H3/b11-7+,12-8+ |
| InChIKey | DPTDQIHQSYDVJR-MKICQXMISA-N |
| XLogP | 2.06 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|