C20H28Cl2 — CID 143505485
1,2-dichlorobenzene;ethane;1,2,3,4-tetrahydronaphthalene (PubChem CID 143505485) has the molecular formula C20H28Cl2 and a molecular weight of 339.35 g/mol. Its IUPAC name is 1,2-dichlorobenzene;ethane;1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1,2-dichlorobenzene;ethane;1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 143505485 |
| Molecular Formula | C20H28Cl2 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1,2-dichlorobenzene;ethane;1,2,3,4-tetrahydronaphthalene |
| SMILES | CC.CC.Clc1ccccc1Cl.c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C10H12.C6H4Cl2.2C2H6/c1-2-6-10-8-4-3-7-9(10)5-1;7-5-3-1-2-4-6(5)8;2*1-2/h1-2,5-6H,3-4,7-8H2;1-4H;2*1-2H3 |
| InChIKey | QDAXMNWACWEEJC-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |