About ethane;2-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-3,5-dimethylpyridine
ethane;2-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-3,5-dimethylpyridine (PubChem CID 143505536) has the molecular formula C19H26FNO
and a molecular weight of 303.42 g/mol. Its IUPAC name is ethane;2-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-3,5-dimethylpyridine.
Molecular Properties
| Compound Name | ethane;2-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-3,5-dimethylpyridine |
| PubChem CID | 143505536 |
| Molecular Formula | C19H26FNO |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | ethane;2-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-3,5-dimethylpyridine |
| SMILES | CC.COc1cc(F)c(C(C)C)cc1-c1ncc(C)cc1C |
| InChI | InChI=1S/C17H20FNO.C2H6/c1-10(2)13-7-14(16(20-5)8-15(13)18)17-12(4)6-11(3)9-19-17;1-2/h6-10H,1-5H3;1-2H3 |
| InChIKey | OPWZCVZEERZFRA-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-3,5-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-3,5-dimethylpyridine?
The IUPAC name of ethane;2-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-3,5-dimethylpyridine (CID 143505536) is ethane;2-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-3,5-dimethylpyridine.
What is the SMILES notation for ethane;2-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-3,5-dimethylpyridine?
The canonical SMILES for ethane;2-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-3,5-dimethylpyridine is CC.COc1cc(F)c(C(C)C)cc1-c1ncc(C)cc1C.
What is the InChIKey of ethane;2-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-3,5-dimethylpyridine?
The InChIKey is OPWZCVZEERZFRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20FNO.C2H6/c1-10(2)13-7-14(16(20-5)8-15(13)18)17-12(4)6-11(3)9-19-17;1-2/h6-10H,1-5H3;1-2H3.
What are the key properties of ethane;2-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-3,5-dimethylpyridine?
ethane;2-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-3,5-dimethylpyridine has a molecular weight of 303.42 g/mol, XLogP of 5.66, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-3,5-dimethylpyridine is sourced from PubChem (CID 143505536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).