About ethane;5-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-4-methyl-2,3-dihydro-1H-indene
ethane;5-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-4-methyl-2,3-dihydro-1H-indene (PubChem CID 143505651) has the molecular formula C24H35FO
and a molecular weight of 358.54 g/mol. Its IUPAC name is ethane;5-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-4-methyl-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | ethane;5-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-4-methyl-2,3-dihydro-1H-indene |
| PubChem CID | 143505651 |
| Molecular Formula | C24H35FO |
| Molecular Weight | 358.54 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | ethane;5-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-4-methyl-2,3-dihydro-1H-indene |
| SMILES | CC.CC.COc1cc(F)c(C(C)C)cc1-c1ccc2c(c1C)CCC2 |
| InChI | InChI=1S/C20H23FO.2C2H6/c1-12(2)17-10-18(20(22-4)11-19(17)21)16-9-8-14-6-5-7-15(14)13(16)3;2*1-2/h8-12H,5-7H2,1-4H3;2*1-2H3 |
| InChIKey | UKVPFHRGTMAOLJ-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.54 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;5-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-4-methyl-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-4-methyl-2,3-dihydro-1H-indene?
The IUPAC name of ethane;5-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-4-methyl-2,3-dihydro-1H-indene (CID 143505651) is ethane;5-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-4-methyl-2,3-dihydro-1H-indene.
What is the SMILES notation for ethane;5-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-4-methyl-2,3-dihydro-1H-indene?
The canonical SMILES for ethane;5-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-4-methyl-2,3-dihydro-1H-indene is CC.CC.COc1cc(F)c(C(C)C)cc1-c1ccc2c(c1C)CCC2.
What is the InChIKey of ethane;5-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-4-methyl-2,3-dihydro-1H-indene?
The InChIKey is UKVPFHRGTMAOLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23FO.2C2H6/c1-12(2)17-10-18(20(22-4)11-19(17)21)16-9-8-14-6-5-7-15(14)13(16)3;2*1-2/h8-12H,5-7H2,1-4H3;2*1-2H3.
What are the key properties of ethane;5-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-4-methyl-2,3-dihydro-1H-indene?
ethane;5-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-4-methyl-2,3-dihydro-1H-indene has a molecular weight of 358.54 g/mol, XLogP of 7.47, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-4-methyl-2,3-dihydro-1H-indene is sourced from PubChem (CID 143505651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).