C15H21NO2 — CID 143505654
ethane;(5R)-5-[(3E)-hexa-1,3,5-trien-3-yl]-4-methyl-3-prop-2-ynyl-1,3-oxazolidin-2-one (PubChem CID 143505654) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is ethane;(5R)-5-[(3E)-hexa-1,3,5-trien-3-yl]-4-methyl-3-prop-2-ynyl-1,3-oxazolidin-2-one.
| Compound Name | ethane;(5R)-5-[(3E)-hexa-1,3,5-trien-3-yl]-4-methyl-3-prop-2-ynyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 143505654 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | ethane;(5R)-5-[(3E)-hexa-1,3,5-trien-3-yl]-4-methyl-3-prop-2-ynyl-1,3-oxazolidin-2-one |
| SMILES | C#CCN1C(=O)O[C@H](/C(C=C)=C/C=C)C1C.CC |
| InChI | InChI=1S/C13H15NO2.C2H6/c1-5-8-11(7-3)12-10(4)14(9-6-2)13(15)16-12;1-2/h2,5,7-8,10,12H,1,3,9H2,4H3;1-2H3/b11-8+;/t10?,12-;/m0./s1 |
| InChIKey | OSAKPMOSVSKNDA-PGGAZYQNSA-N |
| XLogP | 3.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|