C36H30F9NO5 — CID 143505733
4-[3-[2-[[(4S,6S)-6-[3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-4-methyl-2-oxo-1,3-oxazinan-3-yl]methyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]-3-methylbenzoic acid (PubChem CID 143505733) has the molecular formula C36H30F9NO5 and a molecular weight of 727.62 g/mol. Its IUPAC name is 4-[3-[2-[[(4S,6S)-6-[3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-4-methyl-2-oxo-1,3-oxazinan-3-yl]methyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]-3-methylbenzoic acid.
| Compound Name | 4-[3-[2-[[(4S,6S)-6-[3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-4-methyl-2-oxo-1,3-oxazinan-3-yl]methyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 143505733 |
| Molecular Formula | C36H30F9NO5 |
| Molecular Weight | 727.62 g/mol |
| Exact Mass | 727.20 |
| IUPAC Name | 4-[3-[2-[[(4S,6S)-6-[3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-4-methyl-2-oxo-1,3-oxazinan-3-yl]methyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]-3-methylbenzoic acid |
| SMILES | COc1ccc(-c2ccc(C(=O)O)cc2C)cc1-c1ccc(C(F)(F)F)cc1CN1C(=O)O[C@H](C2C=C(C(F)(F)F)C=C(C(F)(F)F)C2)C[C@@H]1C |
| InChI | InChI=1S/C36H30F9NO5/c1-18-10-21(32(47)48)4-7-27(18)20-5-9-30(50-3)29(15-20)28-8-6-24(34(37,38)39)14-23(28)17-46-19(2)11-31(51-33(46)49)22-12-25(35(40,41)42)16-26(13-22)36(43,44)45/h4-10,12,14-16,19,22,31H,11,13,17H2,1-3H3,(H,47,48)/t19-,22?,31-/m0/s1 |
| InChIKey | AEHSEWDPLYNVNJ-NPHHGCHESA-N |
| XLogP | 10.15 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.62 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |