C20H20BrF2N2O3P — CID 143505962
[[4-[(6-amino-1,2,3,4-tetrahydrocarbazol-9-yl)methyl]-2-bromophenyl]-difluoromethyl]phosphonic acid (PubChem CID 143505962) has the molecular formula C20H20BrF2N2O3P and a molecular weight of 485.27 g/mol. Its IUPAC name is [[4-[(6-amino-1,2,3,4-tetrahydrocarbazol-9-yl)methyl]-2-bromophenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[4-[(6-amino-1,2,3,4-tetrahydrocarbazol-9-yl)methyl]-2-bromophenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 143505962 |
| Molecular Formula | C20H20BrF2N2O3P |
| Molecular Weight | 485.27 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | [[4-[(6-amino-1,2,3,4-tetrahydrocarbazol-9-yl)methyl]-2-bromophenyl]-difluoromethyl]phosphonic acid |
| SMILES | Nc1ccc2c(c1)c1c(n2Cc2ccc(C(F)(F)P(=O)(O)O)c(Br)c2)CCCC1 |
| InChI | InChI=1S/C20H20BrF2N2O3P/c21-17-9-12(5-7-16(17)20(22,23)29(26,27)28)11-25-18-4-2-1-3-14(18)15-10-13(24)6-8-19(15)25/h5-10H,1-4,11,24H2,(H2,26,27,28) |
| InChIKey | QOIZXNOWUWUHDT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.27 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|