About 1-butan-2-yl-2-chlorobenzene;cyclohexanecarbonitrile;ethane
1-butan-2-yl-2-chlorobenzene;cyclohexanecarbonitrile;ethane (PubChem CID 143506213) has the molecular formula C21H36ClN
and a molecular weight of 337.98 g/mol. Its IUPAC name is 1-butan-2-yl-2-chlorobenzene;cyclohexanecarbonitrile;ethane.
Molecular Properties
| Compound Name | 1-butan-2-yl-2-chlorobenzene;cyclohexanecarbonitrile;ethane |
| PubChem CID | 143506213 |
| Molecular Formula | C21H36ClN |
| Molecular Weight | 337.98 g/mol |
| Exact Mass | 337.25 |
| IUPAC Name | 1-butan-2-yl-2-chlorobenzene;cyclohexanecarbonitrile;ethane |
| SMILES | CC.CC.CCC(C)c1ccccc1Cl.N#CC1CCCCC1 |
| InChI | InChI=1S/C10H13Cl.C7H11N.2C2H6/c1-3-8(2)9-6-4-5-7-10(9)11;8-6-7-4-2-1-3-5-7;2*1-2/h4-8H,3H2,1-2H3;7H,1-5H2;2*1-2H3 |
| InChIKey | GJUIMCSAWPRJNL-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.98 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-butan-2-yl-2-chlorobenzene;cyclohexanecarbonitrile;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-2-chlorobenzene;cyclohexanecarbonitrile;ethane?
The IUPAC name of 1-butan-2-yl-2-chlorobenzene;cyclohexanecarbonitrile;ethane (CID 143506213) is 1-butan-2-yl-2-chlorobenzene;cyclohexanecarbonitrile;ethane.
What is the SMILES notation for 1-butan-2-yl-2-chlorobenzene;cyclohexanecarbonitrile;ethane?
The canonical SMILES for 1-butan-2-yl-2-chlorobenzene;cyclohexanecarbonitrile;ethane is CC.CC.CCC(C)c1ccccc1Cl.N#CC1CCCCC1.
What is the InChIKey of 1-butan-2-yl-2-chlorobenzene;cyclohexanecarbonitrile;ethane?
The InChIKey is GJUIMCSAWPRJNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13Cl.C7H11N.2C2H6/c1-3-8(2)9-6-4-5-7-10(9)11;8-6-7-4-2-1-3-5-7;2*1-2/h4-8H,3H2,1-2H3;7H,1-5H2;2*1-2H3.
What are the key properties of 1-butan-2-yl-2-chlorobenzene;cyclohexanecarbonitrile;ethane?
1-butan-2-yl-2-chlorobenzene;cyclohexanecarbonitrile;ethane has a molecular weight of 337.98 g/mol, XLogP of 8.00, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-2-chlorobenzene;cyclohexanecarbonitrile;ethane is sourced from PubChem (CID 143506213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).