C18H21ClF3N3O2 — CID 14350637
1-[3-chloro-4-(trifluoromethoxy)phenyl]-2,2-dimethyl-4-(1,2,4-triazol-1-yl)hept-6-en-3-ol (PubChem CID 14350637) has the molecular formula C18H21ClF3N3O2 and a molecular weight of 403.83 g/mol. Its IUPAC name is 1-[3-chloro-4-(trifluoromethoxy)phenyl]-2,2-dimethyl-4-(1,2,4-triazol-1-yl)hept-6-en-3-ol.
| Compound Name | 1-[3-chloro-4-(trifluoromethoxy)phenyl]-2,2-dimethyl-4-(1,2,4-triazol-1-yl)hept-6-en-3-ol |
|---|---|
| PubChem CID | 14350637 |
| Molecular Formula | C18H21ClF3N3O2 |
| Molecular Weight | 403.83 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 1-[3-chloro-4-(trifluoromethoxy)phenyl]-2,2-dimethyl-4-(1,2,4-triazol-1-yl)hept-6-en-3-ol |
| SMILES | C=CCC(C(O)C(C)(C)Cc1ccc(OC(F)(F)F)c(Cl)c1)n1cncn1 |
| InChI | InChI=1S/C18H21ClF3N3O2/c1-4-5-14(25-11-23-10-24-25)16(26)17(2,3)9-12-6-7-15(13(19)8-12)27-18(20,21)22/h4,6-8,10-11,14,16,26H,1,5,9H2,2-3H3 |
| InChIKey | LUJMDYAYKFBNRR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.83 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|