C19H27N3O3 — CID 143506548
N-[(4R)-4-(5,6-dimethoxycyclohepta-1,4,6-trien-1-yl)pentyl]-3-methylimidazole-4-carboxamide (PubChem CID 143506548) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is N-[(4R)-4-(5,6-dimethoxycyclohepta-1,4,6-trien-1-yl)pentyl]-3-methylimidazole-4-carboxamide.
| Compound Name | N-[(4R)-4-(5,6-dimethoxycyclohepta-1,4,6-trien-1-yl)pentyl]-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 143506548 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-[(4R)-4-(5,6-dimethoxycyclohepta-1,4,6-trien-1-yl)pentyl]-3-methylimidazole-4-carboxamide |
| SMILES | COC1=CCC=C([C@H](C)CCCNC(=O)c2cncn2C)C=C1OC |
| InChI | InChI=1S/C19H27N3O3/c1-14(15-8-5-9-17(24-3)18(11-15)25-4)7-6-10-21-19(23)16-12-20-13-22(16)2/h8-9,11-14H,5-7,10H2,1-4H3,(H,21,23)/t14-/m1/s1 |
| InChIKey | VPLFNKHYMMJPBY-CQSZACIVSA-N |
| XLogP | 2.96 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|