C13H23NO2 — CID 143506623
(3E,5E)-3-ethenyl-6,7-dimethoxy-N,2-dimethylhepta-3,5-dien-1-amine (PubChem CID 143506623) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is (3E,5E)-3-ethenyl-6,7-dimethoxy-N,2-dimethylhepta-3,5-dien-1-amine.
| Compound Name | (3E,5E)-3-ethenyl-6,7-dimethoxy-N,2-dimethylhepta-3,5-dien-1-amine |
|---|---|
| PubChem CID | 143506623 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | (3E,5E)-3-ethenyl-6,7-dimethoxy-N,2-dimethylhepta-3,5-dien-1-amine |
| SMILES | C=C/C(=C\C=C(/COC)OC)C(C)CNC |
| InChI | InChI=1S/C13H23NO2/c1-6-12(11(2)9-14-3)7-8-13(16-5)10-15-4/h6-8,11,14H,1,9-10H2,2-5H3/b12-7+,13-8+ |
| InChIKey | UENUDRUZDCECMN-INOXDZRUSA-N |
| XLogP | 2.13 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|