C22H38N2 — CID 143507396
N'-[(3E)-1-cyclohexa-1,5-dien-1-yl-3-ethenylhexa-3,5-dien-2-yl]methanediamine;ethene;2-methylbutane (PubChem CID 143507396) has the molecular formula C22H38N2 and a molecular weight of 330.56 g/mol. Its IUPAC name is N'-[(3E)-1-cyclohexa-1,5-dien-1-yl-3-ethenylhexa-3,5-dien-2-yl]methanediamine;ethene;2-methylbutane.
| Compound Name | N'-[(3E)-1-cyclohexa-1,5-dien-1-yl-3-ethenylhexa-3,5-dien-2-yl]methanediamine;ethene;2-methylbutane |
|---|---|
| PubChem CID | 143507396 |
| Molecular Formula | C22H38N2 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.30 |
| IUPAC Name | N'-[(3E)-1-cyclohexa-1,5-dien-1-yl-3-ethenylhexa-3,5-dien-2-yl]methanediamine;ethene;2-methylbutane |
| SMILES | C=C.C=C/C=C(\C=C)C(CC1=CCCC=C1)NCN.CCC(C)C |
| InChI | InChI=1S/C15H22N2.C5H12.C2H4/c1-3-8-14(4-2)15(17-12-16)11-13-9-6-5-7-10-13;1-4-5(2)3;1-2/h3-4,6,8-10,15,17H,1-2,5,7,11-12,16H2;5H,4H2,1-3H3;1-2H2/b14-8+;; |
| InChIKey | NYNQLVOBPZGNDC-JPMXUBAOSA-N |
| XLogP | 5.68 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|