C15H14F4O4 — CID 143508005
[2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl 2-ethenylcyclopropane-1-carboperoxoate (PubChem CID 143508005) has the molecular formula C15H14F4O4 and a molecular weight of 334.27 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl 2-ethenylcyclopropane-1-carboperoxoate.
| Compound Name | [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl 2-ethenylcyclopropane-1-carboperoxoate |
|---|---|
| PubChem CID | 143508005 |
| Molecular Formula | C15H14F4O4 |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl 2-ethenylcyclopropane-1-carboperoxoate |
| SMILES | C=CC1CC1C(=O)OOCc1c(F)c(F)c(COC)c(F)c1F |
| InChI | InChI=1S/C15H14F4O4/c1-3-7-4-8(7)15(20)23-22-6-10-13(18)11(16)9(5-21-2)12(17)14(10)19/h3,7-8H,1,4-6H2,2H3 |
| InChIKey | GCTDZMCKKSYSJE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|