C12H19NO4 — CID 143508321
tert-butyl 2-formyl-2-(2-oxoethyl)pyrrolidine-1-carboxylate (PubChem CID 143508321) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is tert-butyl 2-formyl-2-(2-oxoethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-formyl-2-(2-oxoethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 143508321 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | tert-butyl 2-formyl-2-(2-oxoethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1(C=O)CC=O |
| InChI | InChI=1S/C12H19NO4/c1-11(2,3)17-10(16)13-7-4-5-12(13,9-15)6-8-14/h8-9H,4-7H2,1-3H3 |
| InChIKey | TZMMZWNAAHVHMP-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|