About 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;N-ethylcyclopropanesulfinamide
1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;N-ethylcyclopropanesulfinamide (PubChem CID 143508583) has the molecular formula C22H27Cl3N2OS
and a molecular weight of 473.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;N-ethylcyclopropanesulfinamide.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;N-ethylcyclopropanesulfinamide |
| PubChem CID | 143508583 |
| Molecular Formula | C22H27Cl3N2OS |
| Molecular Weight | 473.90 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;N-ethylcyclopropanesulfinamide |
| SMILES | CCNS(=O)C1CC1.Clc1ccc(N2CCCCC2c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H16Cl3N.C5H11NOS/c18-12-4-7-14(8-5-12)21-10-2-1-3-17(21)15-9-6-13(19)11-16(15)20;1-2-6-8(7)5-3-4-5/h4-9,11,17H,1-3,10H2;5-6H,2-4H2,1H3 |
| InChIKey | NKAWYOAAPPFRIF-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.90 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;N-ethylcyclopropanesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;N-ethylcyclopropanesulfinamide?
The IUPAC name of 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;N-ethylcyclopropanesulfinamide (CID 143508583) is 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;N-ethylcyclopropanesulfinamide.
What is the SMILES notation for 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;N-ethylcyclopropanesulfinamide?
The canonical SMILES for 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;N-ethylcyclopropanesulfinamide is CCNS(=O)C1CC1.Clc1ccc(N2CCCCC2c2ccc(Cl)cc2Cl)cc1.
What is the InChIKey of 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;N-ethylcyclopropanesulfinamide?
The InChIKey is NKAWYOAAPPFRIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16Cl3N.C5H11NOS/c18-12-4-7-14(8-5-12)21-10-2-1-3-17(21)15-9-6-13(19)11-16(15)20;1-2-6-8(7)5-3-4-5/h4-9,11,17H,1-3,10H2;5-6H,2-4H2,1H3.
What are the key properties of 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;N-ethylcyclopropanesulfinamide?
1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;N-ethylcyclopropanesulfinamide has a molecular weight of 473.90 g/mol, XLogP of 6.80, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;N-ethylcyclopropanesulfinamide is sourced from PubChem (CID 143508583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).