C22H23Cl3N2O — CID 143508648
(2Z)-1-[[2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)piperidin-4-yl]amino]penta-2,4-dien-2-ol (PubChem CID 143508648) has the molecular formula C22H23Cl3N2O and a molecular weight of 437.80 g/mol. Its IUPAC name is (2Z)-1-[[2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)piperidin-4-yl]amino]penta-2,4-dien-2-ol.
| Compound Name | (2Z)-1-[[2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)piperidin-4-yl]amino]penta-2,4-dien-2-ol |
|---|---|
| PubChem CID | 143508648 |
| Molecular Formula | C22H23Cl3N2O |
| Molecular Weight | 437.80 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | (2Z)-1-[[2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)piperidin-4-yl]amino]penta-2,4-dien-2-ol |
| SMILES | C=C/C=C(\O)CNC1CCN(c2ccc(Cl)cc2Cl)C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C22H23Cl3N2O/c1-2-3-19(28)14-26-18-10-11-27(21-9-8-17(24)12-20(21)25)22(13-18)15-4-6-16(23)7-5-15/h2-9,12,18,22,26,28H,1,10-11,13-14H2/b19-3- |
| InChIKey | QSSUYDRLHPWOTG-OQOIWIOPSA-N |
| XLogP | 6.57 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.80 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|