C25H29F3N4OS — CID 143508961
4-[(1E,3E)-2-[2-[[2-amino-3-[4-(trifluoromethyl)phenyl]propyl]amino]-1,3-thiazol-5-yl]hepta-1,3-dienyl]-5-methyl-1,3-dihydropyrrol-2-one (PubChem CID 143508961) has the molecular formula C25H29F3N4OS and a molecular weight of 490.60 g/mol. Its IUPAC name is 4-[(1E,3E)-2-[2-[[2-amino-3-[4-(trifluoromethyl)phenyl]propyl]amino]-1,3-thiazol-5-yl]hepta-1,3-dienyl]-5-methyl-1,3-dihydropyrrol-2-one.
| Compound Name | 4-[(1E,3E)-2-[2-[[2-amino-3-[4-(trifluoromethyl)phenyl]propyl]amino]-1,3-thiazol-5-yl]hepta-1,3-dienyl]-5-methyl-1,3-dihydropyrrol-2-one |
|---|---|
| PubChem CID | 143508961 |
| Molecular Formula | C25H29F3N4OS |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 4-[(1E,3E)-2-[2-[[2-amino-3-[4-(trifluoromethyl)phenyl]propyl]amino]-1,3-thiazol-5-yl]hepta-1,3-dienyl]-5-methyl-1,3-dihydropyrrol-2-one |
| SMILES | CCC/C=C/C(=C\C1=C(C)NC(=O)C1)c1cnc(NCC(N)Cc2ccc(C(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C25H29F3N4OS/c1-3-4-5-6-18(12-19-13-23(33)32-16(19)2)22-15-31-24(34-22)30-14-21(29)11-17-7-9-20(10-8-17)25(26,27)28/h5-10,12,15,21H,3-4,11,13-14,29H2,1-2H3,(H,30,31)(H,32,33)/b6-5+,18-12+ |
| InChIKey | DHQFYBYOVAYRGT-YADWXFRQSA-N |
| XLogP | 5.68 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|