C23H27F2N3OS — CID 143509011
[(E)-2-methyl-3-[2-oxo-5-[(Z)-prop-1-enyl]-1,3-dihydropyrrol-4-yl]prop-2-enyl] N'-[3-(3,4-difluorophenyl)propyl]-N-ethenylcarbamimidothioate (PubChem CID 143509011) has the molecular formula C23H27F2N3OS and a molecular weight of 431.55 g/mol. Its IUPAC name is [(E)-2-methyl-3-[2-oxo-5-[(Z)-prop-1-enyl]-1,3-dihydropyrrol-4-yl]prop-2-enyl] N'-[3-(3,4-difluorophenyl)propyl]-N-ethenylcarbamimidothioate.
| Compound Name | [(E)-2-methyl-3-[2-oxo-5-[(Z)-prop-1-enyl]-1,3-dihydropyrrol-4-yl]prop-2-enyl] N'-[3-(3,4-difluorophenyl)propyl]-N-ethenylcarbamimidothioate |
|---|---|
| PubChem CID | 143509011 |
| Molecular Formula | C23H27F2N3OS |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | [(E)-2-methyl-3-[2-oxo-5-[(Z)-prop-1-enyl]-1,3-dihydropyrrol-4-yl]prop-2-enyl] N'-[3-(3,4-difluorophenyl)propyl]-N-ethenylcarbamimidothioate |
| SMILES | C=CN/C(=N/CCCc1ccc(F)c(F)c1)SC/C(C)=C/C1=C(/C=C\C)NC(=O)C1 |
| InChI | InChI=1S/C23H27F2N3OS/c1-4-7-21-18(14-22(29)28-21)12-16(3)15-30-23(26-5-2)27-11-6-8-17-9-10-19(24)20(25)13-17/h4-5,7,9-10,12-13H,2,6,8,11,14-15H2,1,3H3,(H,26,27)(H,28,29)/b7-4-,16-12+ |
| InChIKey | WFUVXQOHWVCARP-XSBRNNJSSA-N |
| XLogP | 5.02 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|