C14H25N3O — CID 143509551
1-[2-(methylamino)ethyl]-3-(3-methylphenyl)-1-propylurea;molecular hydrogen (PubChem CID 143509551) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is 1-[2-(methylamino)ethyl]-3-(3-methylphenyl)-1-propylurea;molecular hydrogen.
| Compound Name | 1-[2-(methylamino)ethyl]-3-(3-methylphenyl)-1-propylurea;molecular hydrogen |
|---|---|
| PubChem CID | 143509551 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 1-[2-(methylamino)ethyl]-3-(3-methylphenyl)-1-propylurea;molecular hydrogen |
| SMILES | CCCN(CCNC)C(=O)Nc1cccc(C)c1.[H][H] |
| InChI | InChI=1S/C14H23N3O.H2/c1-4-9-17(10-8-15-3)14(18)16-13-7-5-6-12(2)11-13;/h5-7,11,15H,4,8-10H2,1-3H3,(H,16,18);1H |
| InChIKey | OXZQDWYEPOWUIP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |