About 2,2-dimethylpropan-1-amine;ethane;prop-1-ynylbenzene
2,2-dimethylpropan-1-amine;ethane;prop-1-ynylbenzene (PubChem CID 143509882) has the molecular formula C16H27N
and a molecular weight of 233.40 g/mol. Its IUPAC name is 2,2-dimethylpropan-1-amine;ethane;prop-1-ynylbenzene.
Molecular Properties
| Compound Name | 2,2-dimethylpropan-1-amine;ethane;prop-1-ynylbenzene |
| PubChem CID | 143509882 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 2,2-dimethylpropan-1-amine;ethane;prop-1-ynylbenzene |
| SMILES | CC.CC#Cc1ccccc1.CC(C)(C)CN |
| InChI | InChI=1S/C9H8.C5H13N.C2H6/c1-2-6-9-7-4-3-5-8-9;1-5(2,3)4-6;1-2/h3-5,7-8H,1H3;4,6H2,1-3H3;1-2H3 |
| InChIKey | XPKPRXYRWSICPJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylpropan-1-amine;ethane;prop-1-ynylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropan-1-amine;ethane;prop-1-ynylbenzene?
The IUPAC name of 2,2-dimethylpropan-1-amine;ethane;prop-1-ynylbenzene (CID 143509882) is 2,2-dimethylpropan-1-amine;ethane;prop-1-ynylbenzene.
What is the SMILES notation for 2,2-dimethylpropan-1-amine;ethane;prop-1-ynylbenzene?
The canonical SMILES for 2,2-dimethylpropan-1-amine;ethane;prop-1-ynylbenzene is CC.CC#Cc1ccccc1.CC(C)(C)CN.
What is the InChIKey of 2,2-dimethylpropan-1-amine;ethane;prop-1-ynylbenzene?
The InChIKey is XPKPRXYRWSICPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8.C5H13N.C2H6/c1-2-6-9-7-4-3-5-8-9;1-5(2,3)4-6;1-2/h3-5,7-8H,1H3;4,6H2,1-3H3;1-2H3.
What are the key properties of 2,2-dimethylpropan-1-amine;ethane;prop-1-ynylbenzene?
2,2-dimethylpropan-1-amine;ethane;prop-1-ynylbenzene has a molecular weight of 233.40 g/mol, XLogP of 4.08, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropan-1-amine;ethane;prop-1-ynylbenzene is sourced from PubChem (CID 143509882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).