C16H27N — CID 143509882
2,2-dimethylpropan-1-amine;ethane;prop-1-ynylbenzene (PubChem CID 143509882) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 2,2-dimethylpropan-1-amine;ethane;prop-1-ynylbenzene.
| Compound Name | 2,2-dimethylpropan-1-amine;ethane;prop-1-ynylbenzene |
|---|---|
| PubChem CID | 143509882 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 2,2-dimethylpropan-1-amine;ethane;prop-1-ynylbenzene |
| SMILES | CC.CC#Cc1ccccc1.CC(C)(C)CN |
| InChI | InChI=1S/C9H8.C5H13N.C2H6/c1-2-6-9-7-4-3-5-8-9;1-5(2,3)4-6;1-2/h3-5,7-8H,1H3;4,6H2,1-3H3;1-2H3 |
| InChIKey | XPKPRXYRWSICPJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|