C19H29N3 — CID 143510031
(5Z,7E,8Z)-2-N-ethenyl-7-ethylidene-3-N-methyl-4-methylidene-8-(methyliminomethyl)undeca-1,5,8-triene-2,3-diamine (PubChem CID 143510031) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is (5Z,7E,8Z)-2-N-ethenyl-7-ethylidene-3-N-methyl-4-methylidene-8-(methyliminomethyl)undeca-1,5,8-triene-2,3-diamine.
| Compound Name | (5Z,7E,8Z)-2-N-ethenyl-7-ethylidene-3-N-methyl-4-methylidene-8-(methyliminomethyl)undeca-1,5,8-triene-2,3-diamine |
|---|---|
| PubChem CID | 143510031 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | (5Z,7E,8Z)-2-N-ethenyl-7-ethylidene-3-N-methyl-4-methylidene-8-(methyliminomethyl)undeca-1,5,8-triene-2,3-diamine |
| SMILES | C=CNC(=C)C(NC)C(=C)/C=C\C(=C/C)C(=C\CC)\C=N\C |
| InChI | InChI=1S/C19H29N3/c1-8-11-18(14-20-6)17(9-2)13-12-15(4)19(21-7)16(5)22-10-3/h9-14,19,21-22H,3-5,8H2,1-2,6-7H3/b13-12-,17-9+,18-11+,20-14+ |
| InChIKey | CNVBSGWTUBHBOM-QMWWPDOISA-N |
| XLogP | 3.92 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|