C23H27N3O5 — CID 143510126
(Z)-but-2-ene;(5R)-5-[[6-(4-hydroxybut-2-ynoxy)-3-oxo-1H-isoindol-2-yl]methyl]-5-prop-2-enylimidazolidine-2,4-dione (PubChem CID 143510126) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is (Z)-but-2-ene;(5R)-5-[[6-(4-hydroxybut-2-ynoxy)-3-oxo-1H-isoindol-2-yl]methyl]-5-prop-2-enylimidazolidine-2,4-dione.
| Compound Name | (Z)-but-2-ene;(5R)-5-[[6-(4-hydroxybut-2-ynoxy)-3-oxo-1H-isoindol-2-yl]methyl]-5-prop-2-enylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143510126 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | (Z)-but-2-ene;(5R)-5-[[6-(4-hydroxybut-2-ynoxy)-3-oxo-1H-isoindol-2-yl]methyl]-5-prop-2-enylimidazolidine-2,4-dione |
| SMILES | C/C=C\C.C=CC[C@]1(CN2Cc3cc(OCC#CCO)ccc3C2=O)NC(=O)NC1=O |
| InChI | InChI=1S/C19H19N3O5.C4H8/c1-2-7-19(17(25)20-18(26)21-19)12-22-11-13-10-14(27-9-4-3-8-23)5-6-15(13)16(22)24;1-3-4-2/h2,5-6,10,23H,1,7-9,11-12H2,(H2,20,21,25,26);3-4H,1-2H3/b;4-3-/t19-;/m1./s1 |
| InChIKey | RJQOUZSNYQQSDB-XCUVADDPSA-N |
| XLogP | 1.75 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|