C12H11FN2O3 — CID 143510384
5-[4-ethenyl-5-[(E)-1-fluoroprop-1-enyl]furan-2-yl]imidazolidine-2,4-dione (PubChem CID 143510384) has the molecular formula C12H11FN2O3 and a molecular weight of 250.23 g/mol. Its IUPAC name is 5-[4-ethenyl-5-[(E)-1-fluoroprop-1-enyl]furan-2-yl]imidazolidine-2,4-dione.
| Compound Name | 5-[4-ethenyl-5-[(E)-1-fluoroprop-1-enyl]furan-2-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143510384 |
| Molecular Formula | C12H11FN2O3 |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 5-[4-ethenyl-5-[(E)-1-fluoroprop-1-enyl]furan-2-yl]imidazolidine-2,4-dione |
| SMILES | C=Cc1cc(C2NC(=O)NC2=O)oc1/C(F)=C\C |
| InChI | InChI=1S/C12H11FN2O3/c1-3-6-5-8(18-10(6)7(13)4-2)9-11(16)15-12(17)14-9/h3-5,9H,1H2,2H3,(H2,14,15,16,17)/b7-4+ |
| InChIKey | CKKSRIAOWBPKMK-QPJJXVBHSA-N |
| XLogP | 2.13 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|