C16H23NO2 — CID 143510544
2-[(dimethylamino)methyl]-4-methoxybenzaldehyde;(3Z)-penta-1,3-diene (PubChem CID 143510544) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]-4-methoxybenzaldehyde;(3Z)-penta-1,3-diene.
| Compound Name | 2-[(dimethylamino)methyl]-4-methoxybenzaldehyde;(3Z)-penta-1,3-diene |
|---|---|
| PubChem CID | 143510544 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 2-[(dimethylamino)methyl]-4-methoxybenzaldehyde;(3Z)-penta-1,3-diene |
| SMILES | C=C/C=C\C.COc1ccc(C=O)c(CN(C)C)c1 |
| InChI | InChI=1S/C11H15NO2.C5H8/c1-12(2)7-10-6-11(14-3)5-4-9(10)8-13;1-3-5-4-2/h4-6,8H,7H2,1-3H3;3-5H,1H2,2H3/b;5-4- |
| InChIKey | QYBSEJMYEIAUTJ-GUHKXDMSSA-N |
| XLogP | 3.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|