About ethane;3-methyl-N-(3-morpholin-4-ylpropyl)cyclohexa-1,3-diene-1-carboxamide
ethane;3-methyl-N-(3-morpholin-4-ylpropyl)cyclohexa-1,3-diene-1-carboxamide (PubChem CID 143510897) has the molecular formula C17H30N2O2
and a molecular weight of 294.44 g/mol. Its IUPAC name is ethane;3-methyl-N-(3-morpholin-4-ylpropyl)cyclohexa-1,3-diene-1-carboxamide.
Molecular Properties
| Compound Name | ethane;3-methyl-N-(3-morpholin-4-ylpropyl)cyclohexa-1,3-diene-1-carboxamide |
| PubChem CID | 143510897 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | ethane;3-methyl-N-(3-morpholin-4-ylpropyl)cyclohexa-1,3-diene-1-carboxamide |
| SMILES | CC.CC1=CCCC(C(=O)NCCCN2CCOCC2)=C1 |
| InChI | InChI=1S/C15H24N2O2.C2H6/c1-13-4-2-5-14(12-13)15(18)16-6-3-7-17-8-10-19-11-9-17;1-2/h4,12H,2-3,5-11H2,1H3,(H,16,18);1-2H3 |
| InChIKey | WOQBHBDXVCPEQX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methyl-N-(3-morpholin-4-ylpropyl)cyclohexa-1,3-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-N-(3-morpholin-4-ylpropyl)cyclohexa-1,3-diene-1-carboxamide?
The IUPAC name of ethane;3-methyl-N-(3-morpholin-4-ylpropyl)cyclohexa-1,3-diene-1-carboxamide (CID 143510897) is ethane;3-methyl-N-(3-morpholin-4-ylpropyl)cyclohexa-1,3-diene-1-carboxamide.
What is the SMILES notation for ethane;3-methyl-N-(3-morpholin-4-ylpropyl)cyclohexa-1,3-diene-1-carboxamide?
The canonical SMILES for ethane;3-methyl-N-(3-morpholin-4-ylpropyl)cyclohexa-1,3-diene-1-carboxamide is CC.CC1=CCCC(C(=O)NCCCN2CCOCC2)=C1.
What is the InChIKey of ethane;3-methyl-N-(3-morpholin-4-ylpropyl)cyclohexa-1,3-diene-1-carboxamide?
The InChIKey is WOQBHBDXVCPEQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O2.C2H6/c1-13-4-2-5-14(12-13)15(18)16-6-3-7-17-8-10-19-11-9-17;1-2/h4,12H,2-3,5-11H2,1H3,(H,16,18);1-2H3.
What are the key properties of ethane;3-methyl-N-(3-morpholin-4-ylpropyl)cyclohexa-1,3-diene-1-carboxamide?
ethane;3-methyl-N-(3-morpholin-4-ylpropyl)cyclohexa-1,3-diene-1-carboxamide has a molecular weight of 294.44 g/mol, XLogP of 2.52, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-N-(3-morpholin-4-ylpropyl)cyclohexa-1,3-diene-1-carboxamide is sourced from PubChem (CID 143510897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).