C13H22N2O — CID 143511069
N,4-dimethylcyclohepta-1,4,6-trien-1-amine;N-propylformamide (PubChem CID 143511069) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is N,4-dimethylcyclohepta-1,4,6-trien-1-amine;N-propylformamide.
| Compound Name | N,4-dimethylcyclohepta-1,4,6-trien-1-amine;N-propylformamide |
|---|---|
| PubChem CID | 143511069 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | N,4-dimethylcyclohepta-1,4,6-trien-1-amine;N-propylformamide |
| SMILES | CCCNC=O.CNC1=CCC(C)=CC=C1 |
| InChI | InChI=1S/C9H13N.C4H9NO/c1-8-4-3-5-9(10-2)7-6-8;1-2-3-5-4-6/h3-5,7,10H,6H2,1-2H3;4H,2-3H2,1H3,(H,5,6) |
| InChIKey | LIBBGXCNBNPVDZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|