About methane;1-(4-methylphenyl)imidazolidin-2-one
methane;1-(4-methylphenyl)imidazolidin-2-one (PubChem CID 143511114) has the molecular formula C11H16N2O
and a molecular weight of 192.26 g/mol. Its IUPAC name is methane;1-(4-methylphenyl)imidazolidin-2-one.
Molecular Properties
| Compound Name | methane;1-(4-methylphenyl)imidazolidin-2-one |
| PubChem CID | 143511114 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | methane;1-(4-methylphenyl)imidazolidin-2-one |
| SMILES | C.Cc1ccc(N2CCNC2=O)cc1 |
| InChI | InChI=1S/C10H12N2O.CH4/c1-8-2-4-9(5-3-8)12-7-6-11-10(12)13;/h2-5H,6-7H2,1H3,(H,11,13);1H4 |
| InChIKey | BRNQGECPXSNHSU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methane;1-(4-methylphenyl)imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-(4-methylphenyl)imidazolidin-2-one?
The IUPAC name of methane;1-(4-methylphenyl)imidazolidin-2-one (CID 143511114) is methane;1-(4-methylphenyl)imidazolidin-2-one.
What is the SMILES notation for methane;1-(4-methylphenyl)imidazolidin-2-one?
The canonical SMILES for methane;1-(4-methylphenyl)imidazolidin-2-one is C.Cc1ccc(N2CCNC2=O)cc1.
What is the InChIKey of methane;1-(4-methylphenyl)imidazolidin-2-one?
The InChIKey is BRNQGECPXSNHSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O.CH4/c1-8-2-4-9(5-3-8)12-7-6-11-10(12)13;/h2-5H,6-7H2,1H3,(H,11,13);1H4.
What are the key properties of methane;1-(4-methylphenyl)imidazolidin-2-one?
methane;1-(4-methylphenyl)imidazolidin-2-one has a molecular weight of 192.26 g/mol, XLogP of 2.16, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-(4-methylphenyl)imidazolidin-2-one is sourced from PubChem (CID 143511114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).