About [4-(3-cyano-1-cyclobutyl-6-hydroxyindol-2-yl)phenyl]carbamic acid;ethylcyclopropane
[4-(3-cyano-1-cyclobutyl-6-hydroxyindol-2-yl)phenyl]carbamic acid;ethylcyclopropane (PubChem CID 143511119) has the molecular formula C25H27N3O3
and a molecular weight of 417.51 g/mol. Its IUPAC name is [4-(3-cyano-1-cyclobutyl-6-hydroxyindol-2-yl)phenyl]carbamic acid;ethylcyclopropane.
Molecular Properties
| Compound Name | [4-(3-cyano-1-cyclobutyl-6-hydroxyindol-2-yl)phenyl]carbamic acid;ethylcyclopropane |
| PubChem CID | 143511119 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | [4-(3-cyano-1-cyclobutyl-6-hydroxyindol-2-yl)phenyl]carbamic acid;ethylcyclopropane |
| SMILES | CCC1CC1.N#Cc1c(-c2ccc(NC(=O)O)cc2)n(C2CCC2)c2cc(O)ccc12 |
| InChI | InChI=1S/C20H17N3O3.C5H10/c21-11-17-16-9-8-15(24)10-18(16)23(14-2-1-3-14)19(17)12-4-6-13(7-5-12)22-20(25)26;1-2-5-3-4-5/h4-10,14,22,24H,1-3H2,(H,25,26);5H,2-4H2,1H3 |
| InChIKey | QFNBJBRYFPSVPB-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(3-cyano-1-cyclobutyl-6-hydroxyindol-2-yl)phenyl]carbamic acid;ethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-cyano-1-cyclobutyl-6-hydroxyindol-2-yl)phenyl]carbamic acid;ethylcyclopropane?
The IUPAC name of [4-(3-cyano-1-cyclobutyl-6-hydroxyindol-2-yl)phenyl]carbamic acid;ethylcyclopropane (CID 143511119) is [4-(3-cyano-1-cyclobutyl-6-hydroxyindol-2-yl)phenyl]carbamic acid;ethylcyclopropane.
What is the SMILES notation for [4-(3-cyano-1-cyclobutyl-6-hydroxyindol-2-yl)phenyl]carbamic acid;ethylcyclopropane?
The canonical SMILES for [4-(3-cyano-1-cyclobutyl-6-hydroxyindol-2-yl)phenyl]carbamic acid;ethylcyclopropane is CCC1CC1.N#Cc1c(-c2ccc(NC(=O)O)cc2)n(C2CCC2)c2cc(O)ccc12.
What is the InChIKey of [4-(3-cyano-1-cyclobutyl-6-hydroxyindol-2-yl)phenyl]carbamic acid;ethylcyclopropane?
The InChIKey is QFNBJBRYFPSVPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O3.C5H10/c21-11-17-16-9-8-15(24)10-18(16)23(14-2-1-3-14)19(17)12-4-6-13(7-5-12)22-20(25)26;1-2-5-3-4-5/h4-10,14,22,24H,1-3H2,(H,25,26);5H,2-4H2,1H3.
What are the key properties of [4-(3-cyano-1-cyclobutyl-6-hydroxyindol-2-yl)phenyl]carbamic acid;ethylcyclopropane?
[4-(3-cyano-1-cyclobutyl-6-hydroxyindol-2-yl)phenyl]carbamic acid;ethylcyclopropane has a molecular weight of 417.51 g/mol, XLogP of 6.51, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-cyano-1-cyclobutyl-6-hydroxyindol-2-yl)phenyl]carbamic acid;ethylcyclopropane is sourced from PubChem (CID 143511119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).