C20H17N5O2 — CID 1435118
4-[(3,4-dioxo-10-propan-2-yl-[1,2,4]triazino[4,3-a]benzimidazol-2-yl)methyl]benzonitrile (PubChem CID 1435118) has the molecular formula C20H17N5O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is 4-[(3,4-dioxo-10-propan-2-yl-[1,2,4]triazino[4,3-a]benzimidazol-2-yl)methyl]benzonitrile.
| Compound Name | 4-[(3,4-dioxo-10-propan-2-yl-[1,2,4]triazino[4,3-a]benzimidazol-2-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 1435118 |
| Molecular Formula | C20H17N5O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 4-[(3,4-dioxo-10-propan-2-yl-[1,2,4]triazino[4,3-a]benzimidazol-2-yl)methyl]benzonitrile |
| SMILES | CC(C)n1c2ccccc2n2c(=O)c(=O)n(Cc3ccc(C#N)cc3)nc12 |
| InChI | InChI=1S/C20H17N5O2/c1-13(2)24-16-5-3-4-6-17(16)25-19(27)18(26)23(22-20(24)25)12-15-9-7-14(11-21)8-10-15/h3-10,13H,12H2,1-2H3 |
| InChIKey | GZKCROFJIVQEDR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 85.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|