C25H30Cl2N2O4 — CID 143511837
(4S,7R)-7a-amino-5-(2-chloro-4-ethoxyphenyl)-4-(4-chlorophenyl)-3,7-dimethyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one;formic acid (PubChem CID 143511837) has the molecular formula C25H30Cl2N2O4 and a molecular weight of 493.43 g/mol. Its IUPAC name is (4S,7R)-7a-amino-5-(2-chloro-4-ethoxyphenyl)-4-(4-chlorophenyl)-3,7-dimethyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one;formic acid.
| Compound Name | (4S,7R)-7a-amino-5-(2-chloro-4-ethoxyphenyl)-4-(4-chlorophenyl)-3,7-dimethyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one;formic acid |
|---|---|
| PubChem CID | 143511837 |
| Molecular Formula | C25H30Cl2N2O4 |
| Molecular Weight | 493.43 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | (4S,7R)-7a-amino-5-(2-chloro-4-ethoxyphenyl)-4-(4-chlorophenyl)-3,7-dimethyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one;formic acid |
| SMILES | CCOc1ccc(C2C[C@@H](C)C3(N)C(=O)NC(C)C3[C@H]2c2ccc(Cl)cc2)c(Cl)c1.O=CO |
| InChI | InChI=1S/C24H28Cl2N2O2.CH2O2/c1-4-30-17-9-10-18(20(26)12-17)19-11-13(2)24(27)22(14(3)28-23(24)29)21(19)15-5-7-16(25)8-6-15;2-1-3/h5-10,12-14,19,21-22H,4,11,27H2,1-3H3,(H,28,29);1H,(H,2,3)/t13-,14?,19?,21+,22?,24?;/m1./s1 |
| InChIKey | UNXMCVIDVJPFAU-LSSRWTFYSA-N |
| XLogP | 4.83 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|