C23H26Cl3N — CID 143512154
(7S)-7-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-3-methylidene-1,2,3a,4,5,6,7,7a-octahydroisoindole;ethane (PubChem CID 143512154) has the molecular formula C23H26Cl3N and a molecular weight of 422.83 g/mol. Its IUPAC name is (7S)-7-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-3-methylidene-1,2,3a,4,5,6,7,7a-octahydroisoindole;ethane.
| Compound Name | (7S)-7-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-3-methylidene-1,2,3a,4,5,6,7,7a-octahydroisoindole;ethane |
|---|---|
| PubChem CID | 143512154 |
| Molecular Formula | C23H26Cl3N |
| Molecular Weight | 422.83 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | (7S)-7-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-3-methylidene-1,2,3a,4,5,6,7,7a-octahydroisoindole;ethane |
| SMILES | C=C1NCC2C1CCC(c1ccc(Cl)cc1Cl)[C@@H]2c1ccc(Cl)cc1.CC |
| InChI | InChI=1S/C21H20Cl3N.C2H6/c1-12-16-8-9-18(17-7-6-15(23)10-20(17)24)21(19(16)11-25-12)13-2-4-14(22)5-3-13;1-2/h2-7,10,16,18-19,21,25H,1,8-9,11H2;1-2H3/t16?,18?,19?,21-;/m0./s1 |
| InChIKey | HZVGMEIQVSUJBB-JAPHZUFQSA-N |
| XLogP | 7.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.83 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |