C26H33Cl2N3O4S — CID 143512214
N-[2-[4-[(3R,3aS,4S,5S,7aR)-5-amino-4-(4-chlorophenyl)-3,7a-dimethyl-1-oxo-2,3,3a,4,6,7-hexahydroisoindol-5-yl]-3-chlorophenoxy]ethyl]ethanesulfonamide (PubChem CID 143512214) has the molecular formula C26H33Cl2N3O4S and a molecular weight of 554.54 g/mol. Its IUPAC name is N-[2-[4-[(3R,3aS,4S,5S,7aR)-5-amino-4-(4-chlorophenyl)-3,7a-dimethyl-1-oxo-2,3,3a,4,6,7-hexahydroisoindol-5-yl]-3-chlorophenoxy]ethyl]ethanesulfonamide.
| Compound Name | N-[2-[4-[(3R,3aS,4S,5S,7aR)-5-amino-4-(4-chlorophenyl)-3,7a-dimethyl-1-oxo-2,3,3a,4,6,7-hexahydroisoindol-5-yl]-3-chlorophenoxy]ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 143512214 |
| Molecular Formula | C26H33Cl2N3O4S |
| Molecular Weight | 554.54 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | N-[2-[4-[(3R,3aS,4S,5S,7aR)-5-amino-4-(4-chlorophenyl)-3,7a-dimethyl-1-oxo-2,3,3a,4,6,7-hexahydroisoindol-5-yl]-3-chlorophenoxy]ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCOc1ccc([C@]2(N)CC[C@@]3(C)C(=O)N[C@H](C)[C@H]3[C@H]2c2ccc(Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C26H33Cl2N3O4S/c1-4-36(33,34)30-13-14-35-19-9-10-20(21(28)15-19)26(29)12-11-25(3)22(16(2)31-24(25)32)23(26)17-5-7-18(27)8-6-17/h5-10,15-16,22-23,30H,4,11-14,29H2,1-3H3,(H,31,32)/t16-,22+,23-,25-,26-/m1/s1 |
| InChIKey | WQRYZXPYPISZNF-VZTWIUGCSA-N |
| XLogP | 4.18 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|