C26H33ClN2O — CID 143512314
4-[4-(4-chlorophenyl)-1-oxo-2,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-3-methylbenzonitrile;ethane (PubChem CID 143512314) has the molecular formula C26H33ClN2O and a molecular weight of 425.02 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)-1-oxo-2,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-3-methylbenzonitrile;ethane.
| Compound Name | 4-[4-(4-chlorophenyl)-1-oxo-2,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-3-methylbenzonitrile;ethane |
|---|---|
| PubChem CID | 143512314 |
| Molecular Formula | C26H33ClN2O |
| Molecular Weight | 425.02 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 4-[4-(4-chlorophenyl)-1-oxo-2,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-3-methylbenzonitrile;ethane |
| SMILES | CC.CC.Cc1cc(C#N)ccc1C1CCC2C(=O)NCC2C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21ClN2O.2C2H6/c1-13-10-14(11-24)2-7-17(13)18-8-9-19-20(12-25-22(19)26)21(18)15-3-5-16(23)6-4-15;2*1-2/h2-7,10,18-21H,8-9,12H2,1H3,(H,25,26);2*1-2H3 |
| InChIKey | XNKXFFUCNVPZPB-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.02 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |