C29H37Cl2NO4 — CID 143512354
(3aS,4S,5R,7aR)-5-[2-chloro-4-[2-(2-methoxyethoxy)ethoxy]phenyl]-4-(4-chlorophenyl)-7a-ethyl-3,3-dimethyl-2,3a,4,5,6,7-hexahydroisoindol-1-one (PubChem CID 143512354) has the molecular formula C29H37Cl2NO4 and a molecular weight of 534.52 g/mol. Its IUPAC name is (3aS,4S,5R,7aR)-5-[2-chloro-4-[2-(2-methoxyethoxy)ethoxy]phenyl]-4-(4-chlorophenyl)-7a-ethyl-3,3-dimethyl-2,3a,4,5,6,7-hexahydroisoindol-1-one.
| Compound Name | (3aS,4S,5R,7aR)-5-[2-chloro-4-[2-(2-methoxyethoxy)ethoxy]phenyl]-4-(4-chlorophenyl)-7a-ethyl-3,3-dimethyl-2,3a,4,5,6,7-hexahydroisoindol-1-one |
|---|---|
| PubChem CID | 143512354 |
| Molecular Formula | C29H37Cl2NO4 |
| Molecular Weight | 534.52 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | (3aS,4S,5R,7aR)-5-[2-chloro-4-[2-(2-methoxyethoxy)ethoxy]phenyl]-4-(4-chlorophenyl)-7a-ethyl-3,3-dimethyl-2,3a,4,5,6,7-hexahydroisoindol-1-one |
| SMILES | CC[C@@]12CC[C@@H](c3ccc(OCCOCCOC)cc3Cl)[C@H](c3ccc(Cl)cc3)[C@@H]1C(C)(C)NC2=O |
| InChI | InChI=1S/C29H37Cl2NO4/c1-5-29-13-12-23(22-11-10-21(18-24(22)31)36-17-16-35-15-14-34-4)25(19-6-8-20(30)9-7-19)26(29)28(2,3)32-27(29)33/h6-11,18,23,25-26H,5,12-17H2,1-4H3,(H,32,33)/t23-,25-,26+,29+/m0/s1 |
| InChIKey | HLCWMVKVTAKFSM-PVUQUFGYSA-N |
| XLogP | 6.62 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.52 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|