C21H20Cl3NO — CID 143512425
chlorobenzene;5-(2,4-dichlorophenyl)-7-methyl-2,3,3a,4,5,7a-hexahydroisoindol-1-one (PubChem CID 143512425) has the molecular formula C21H20Cl3NO and a molecular weight of 408.76 g/mol. Its IUPAC name is chlorobenzene;5-(2,4-dichlorophenyl)-7-methyl-2,3,3a,4,5,7a-hexahydroisoindol-1-one.
| Compound Name | chlorobenzene;5-(2,4-dichlorophenyl)-7-methyl-2,3,3a,4,5,7a-hexahydroisoindol-1-one |
|---|---|
| PubChem CID | 143512425 |
| Molecular Formula | C21H20Cl3NO |
| Molecular Weight | 408.76 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | chlorobenzene;5-(2,4-dichlorophenyl)-7-methyl-2,3,3a,4,5,7a-hexahydroisoindol-1-one |
| SMILES | CC1=CC(c2ccc(Cl)cc2Cl)CC2CNC(=O)C12.Clc1ccccc1 |
| InChI | InChI=1S/C15H15Cl2NO.C6H5Cl/c1-8-4-9(5-10-7-18-15(19)14(8)10)12-3-2-11(16)6-13(12)17;7-6-4-2-1-3-5-6/h2-4,6,9-10,14H,5,7H2,1H3,(H,18,19);1-5H |
| InChIKey | PVNCNPCMLJYAAU-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.76 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|