C8H7N3O2S — CID 143512545
5-[2-(2,3-dihydro-1,3-thiazol-2-yl)ethynyl]imidazolidine-2,4-dione (PubChem CID 143512545) has the molecular formula C8H7N3O2S and a molecular weight of 209.23 g/mol. Its IUPAC name is 5-[2-(2,3-dihydro-1,3-thiazol-2-yl)ethynyl]imidazolidine-2,4-dione.
| Compound Name | 5-[2-(2,3-dihydro-1,3-thiazol-2-yl)ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143512545 |
| Molecular Formula | C8H7N3O2S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 5-[2-(2,3-dihydro-1,3-thiazol-2-yl)ethynyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(C#CC2NC=CS2)N1 |
| InChI | InChI=1S/C8H7N3O2S/c12-7-5(10-8(13)11-7)1-2-6-9-3-4-14-6/h3-6,9H,(H2,10,11,12,13) |
| InChIKey | DYNSOUBKZPKLRI-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|