C26H32N4O4 — CID 143512769
ethane;5-ethyl-2-(methylaminomethyl)benzaldehyde;5-[5-[(E)-hydroxyiminomethyl]-1H-inden-2-yl]imidazolidine-2,4-dione (PubChem CID 143512769) has the molecular formula C26H32N4O4 and a molecular weight of 464.57 g/mol. Its IUPAC name is ethane;5-ethyl-2-(methylaminomethyl)benzaldehyde;5-[5-[(E)-hydroxyiminomethyl]-1H-inden-2-yl]imidazolidine-2,4-dione.
| Compound Name | ethane;5-ethyl-2-(methylaminomethyl)benzaldehyde;5-[5-[(E)-hydroxyiminomethyl]-1H-inden-2-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143512769 |
| Molecular Formula | C26H32N4O4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | ethane;5-ethyl-2-(methylaminomethyl)benzaldehyde;5-[5-[(E)-hydroxyiminomethyl]-1H-inden-2-yl]imidazolidine-2,4-dione |
| SMILES | CC.CCc1ccc(CNC)c(C=O)c1.O=C1NC(=O)C(C2=Cc3cc(/C=N/O)ccc3C2)N1 |
| InChI | InChI=1S/C13H11N3O3.C11H15NO.C2H6/c17-12-11(15-13(18)16-12)10-4-8-2-1-7(6-14-19)3-9(8)5-10;1-3-9-4-5-10(7-12-2)11(6-9)8-13;1-2/h1-3,5-6,11,19H,4H2,(H2,15,16,17,18);4-6,8,12H,3,7H2,1-2H3;1-2H3/b14-6+;; |
| InChIKey | UGYSBFBNOOLJFS-OJHGAHPXSA-N |
| XLogP | 3.45 |
| TPSA | 119.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|